C19H12F3NS2 — CID 138972343
3,4-dithiophen-2-yl-1-(2,2,2-trifluoroethyl)isoquinoline (PubChem CID 138972343) has the molecular formula C19H12F3NS2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 3,4-dithiophen-2-yl-1-(2,2,2-trifluoroethyl)isoquinoline.
| Compound Name | 3,4-dithiophen-2-yl-1-(2,2,2-trifluoroethyl)isoquinoline |
|---|---|
| PubChem CID | 138972343 |
| Molecular Formula | C19H12F3NS2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 3,4-dithiophen-2-yl-1-(2,2,2-trifluoroethyl)isoquinoline |
| SMILES | FC(F)(F)Cc1nc(-c2cccs2)c(-c2cccs2)c2ccccc12 |
| InChI | InChI=1S/C19H12F3NS2/c20-19(21,22)11-14-12-5-1-2-6-13(12)17(15-7-3-9-24-15)18(23-14)16-8-4-10-25-16/h1-10H,11H2 |
| InChIKey | JLWDDENWOMFBNP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |