C16H15F3O3S2 — CID 138972398
1-[2-(benzenesulfonyl)-1-(trifluoromethylsulfanyl)ethyl]-3-methoxybenzene (PubChem CID 138972398) has the molecular formula C16H15F3O3S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)-1-(trifluoromethylsulfanyl)ethyl]-3-methoxybenzene.
| Compound Name | 1-[2-(benzenesulfonyl)-1-(trifluoromethylsulfanyl)ethyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 138972398 |
| Molecular Formula | C16H15F3O3S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[2-(benzenesulfonyl)-1-(trifluoromethylsulfanyl)ethyl]-3-methoxybenzene |
| SMILES | COc1cccc(C(CS(=O)(=O)c2ccccc2)SC(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3O3S2/c1-22-13-7-5-6-12(10-13)15(23-16(17,18)19)11-24(20,21)14-8-3-2-4-9-14/h2-10,15H,11H2,1H3 |
| InChIKey | PYLANBBMWZEENR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |