About ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate
ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate (PubChem CID 138972795) has the molecular formula C16H26F4O4
and a molecular weight of 358.37 g/mol. Its IUPAC name is ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate |
| PubChem CID | 138972795 |
| Molecular Formula | C16H26F4O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C(CC(F)F)C(CC(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26F4O4/c1-15(2,3)23-13(21)9(7-11(17)18)10(8-12(19)20)14(22)24-16(4,5)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | IJPRWUWRPMMTEY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The IUPAC name of ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate (CID 138972795) is ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate.
What is the SMILES notation for ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The canonical SMILES for ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate is CC(C)(C)OC(=O)C(CC(F)F)C(CC(F)F)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The InChIKey is IJPRWUWRPMMTEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F4O4/c1-15(2,3)23-13(21)9(7-11(17)18)10(8-12(19)20)14(22)24-16(4,5)6/h9-12H,7-8H2,1-6H3.
What are the key properties of ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate?
ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate has a molecular weight of 358.37 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2,3-bis(2,2-difluoroethyl)butanedioate is sourced from PubChem (CID 138972795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).