C24H30OS — CID 138972854
[(1R,2R,4S)-2-cyclohexyloxy-4-(2-phenylethyl)cyclobutyl]sulfanylbenzene (PubChem CID 138972854) has the molecular formula C24H30OS and a molecular weight of 366.57 g/mol. Its IUPAC name is [(1R,2R,4S)-2-cyclohexyloxy-4-(2-phenylethyl)cyclobutyl]sulfanylbenzene.
| Compound Name | [(1R,2R,4S)-2-cyclohexyloxy-4-(2-phenylethyl)cyclobutyl]sulfanylbenzene |
|---|---|
| PubChem CID | 138972854 |
| Molecular Formula | C24H30OS |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(1R,2R,4S)-2-cyclohexyloxy-4-(2-phenylethyl)cyclobutyl]sulfanylbenzene |
| SMILES | c1ccc(CC[C@H]2C[C@@H](OC3CCCCC3)[C@@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C24H30OS/c1-4-10-19(11-5-1)16-17-20-18-23(25-21-12-6-2-7-13-21)24(20)26-22-14-8-3-9-15-22/h1,3-5,8-11,14-15,20-21,23-24H,2,6-7,12-13,16-18H2/t20-,23+,24+/m0/s1 |
| InChIKey | RYQXMFSTMFACJB-TUACAJSNSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |