C23H15ClN2O2 — CID 138973143
2-(5-chloro-1-methyl-2-phenylindol-3-yl)isoindole-1,3-dione (PubChem CID 138973143) has the molecular formula C23H15ClN2O2 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-(5-chloro-1-methyl-2-phenylindol-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(5-chloro-1-methyl-2-phenylindol-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138973143 |
| Molecular Formula | C23H15ClN2O2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-(5-chloro-1-methyl-2-phenylindol-3-yl)isoindole-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)c(N2C(=O)c3ccccc3C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H15ClN2O2/c1-25-19-12-11-15(24)13-18(19)21(20(25)14-7-3-2-4-8-14)26-22(27)16-9-5-6-10-17(16)23(26)28/h2-13H,1H3 |
| InChIKey | LBSSYMNAMXQJLA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|