C19H19O4Si- — CID 138973317
8-(2-bicyclo[2.2.1]heptanyl)-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 138973317) has the molecular formula C19H19O4Si- and a molecular weight of 339.44 g/mol. Its IUPAC name is 8-(2-bicyclo[2.2.1]heptanyl)-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 8-(2-bicyclo[2.2.1]heptanyl)-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 138973317 |
| Molecular Formula | C19H19O4Si- |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 8-(2-bicyclo[2.2.1]heptanyl)-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | c1ccc2c(c1)O[Si-]1(C3CC4CCC3C4)(O2)Oc2ccccc2O1 |
| InChI | InChI=1S/C19H19O4Si/c1-2-6-16-15(5-1)20-24(21-16,19-12-13-9-10-14(19)11-13)22-17-7-3-4-8-18(17)23-24/h1-8,13-14,19H,9-12H2/q-1 |
| InChIKey | UZRAROJUSCNPRS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|