C19H21FO3S2 — CID 138973395
2-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane (PubChem CID 138973395) has the molecular formula C19H21FO3S2 and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane.
| Compound Name | 2-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 138973395 |
| Molecular Formula | C19H21FO3S2 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiane |
| SMILES | COc1cc(C2(c3ccc(F)cc3)SCCCS2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21FO3S2/c1-21-16-11-14(12-17(22-2)18(16)23-3)19(24-9-4-10-25-19)13-5-7-15(20)8-6-13/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | FNVIRLIJANKQSG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |