About methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate
methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate (PubChem CID 138973525) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate |
| PubChem CID | 138973525 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O4/c1-7(9(11)12-4)5-8-6-13-10(2,3)14-8/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VVTKEIFYRQEKIR-YUMQZZPRSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate?
The IUPAC name of methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate (CID 138973525) is methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate.
What is the SMILES notation for methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate?
The canonical SMILES for methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate is COC(=O)[C@@H](C)C[C@H]1COC(C)(C)O1.
What is the InChIKey of methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate?
The InChIKey is VVTKEIFYRQEKIR-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H18O4/c1-7(9(11)12-4)5-8-6-13-10(2,3)14-8/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1.
What are the key properties of methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate?
methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate has a molecular weight of 202.25 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropanoate is sourced from PubChem (CID 138973525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).