C42H52N2O4 — CID 138973526
dimethyl 3-[benzyl-[(1R)-1-phenylethyl]amino]-8-[benzyl-[(1S)-1-phenylethyl]amino]decanedioate (PubChem CID 138973526) has the molecular formula C42H52N2O4 and a molecular weight of 648.89 g/mol. Its IUPAC name is dimethyl 3-[benzyl-[(1R)-1-phenylethyl]amino]-8-[benzyl-[(1S)-1-phenylethyl]amino]decanedioate.
| Compound Name | dimethyl 3-[benzyl-[(1R)-1-phenylethyl]amino]-8-[benzyl-[(1S)-1-phenylethyl]amino]decanedioate |
|---|---|
| PubChem CID | 138973526 |
| Molecular Formula | C42H52N2O4 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | dimethyl 3-[benzyl-[(1R)-1-phenylethyl]amino]-8-[benzyl-[(1S)-1-phenylethyl]amino]decanedioate |
| SMILES | COC(=O)CC(CCCCC(CC(=O)OC)N(Cc1ccccc1)[C@@H](C)c1ccccc1)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C42H52N2O4/c1-33(37-23-13-7-14-24-37)43(31-35-19-9-5-10-20-35)39(29-41(45)47-3)27-17-18-28-40(30-42(46)48-4)44(32-36-21-11-6-12-22-36)34(2)38-25-15-8-16-26-38/h5-16,19-26,33-34,39-40H,17-18,27-32H2,1-4H3/t33-,34+,39?,40? |
| InChIKey | FLDSMICBCBKJSK-RTTAWKOVSA-N |
| XLogP | 8.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|