C23H26N2O2 — CID 138973589
ethyl 2-cyano-3-phenyl-4-(4-pyrrolidin-1-ylphenyl)butanoate (PubChem CID 138973589) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl 2-cyano-3-phenyl-4-(4-pyrrolidin-1-ylphenyl)butanoate.
| Compound Name | ethyl 2-cyano-3-phenyl-4-(4-pyrrolidin-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 138973589 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 2-cyano-3-phenyl-4-(4-pyrrolidin-1-ylphenyl)butanoate |
| SMILES | CCOC(=O)C(C#N)C(Cc1ccc(N2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c1-2-27-23(26)22(17-24)21(19-8-4-3-5-9-19)16-18-10-12-20(13-11-18)25-14-6-7-15-25/h3-5,8-13,21-22H,2,6-7,14-16H2,1H3 |
| InChIKey | XMAGPNLPIMGRFI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|