C15H14O2 — CID 138973700
7-methyl-4-phenyl-1,3-dihydro-2-benzofuran-5-ol (PubChem CID 138973700) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 7-methyl-4-phenyl-1,3-dihydro-2-benzofuran-5-ol.
| Compound Name | 7-methyl-4-phenyl-1,3-dihydro-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 138973700 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 7-methyl-4-phenyl-1,3-dihydro-2-benzofuran-5-ol |
| SMILES | Cc1cc(O)c(-c2ccccc2)c2c1COC2 |
| InChI | InChI=1S/C15H14O2/c1-10-7-14(16)15(11-5-3-2-4-6-11)13-9-17-8-12(10)13/h2-7,16H,8-9H2,1H3 |
| InChIKey | UGIZCSCIBKVAHH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |