C15H15O4Si- — CID 138973780
8-propyl-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 138973780) has the molecular formula C15H15O4Si- and a molecular weight of 287.37 g/mol. Its IUPAC name is 8-propyl-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 8-propyl-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 138973780 |
| Molecular Formula | C15H15O4Si- |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 8-propyl-8,8'-spirobi[7,9-dioxa-8-silanuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | CCC[Si-]12(Oc3ccccc3O1)Oc1ccccc1O2 |
| InChI | InChI=1S/C15H15O4Si/c1-2-11-20(16-12-7-3-4-8-13(12)17-20)18-14-9-5-6-10-15(14)19-20/h3-10H,2,11H2,1H3/q-1 |
| InChIKey | HCQVYOUHZCEKNX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|