About methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate
methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate (PubChem CID 138973935) has the molecular formula C22H19FO3
and a molecular weight of 350.39 g/mol. Its IUPAC name is methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate.
Molecular Properties
| Compound Name | methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate |
| PubChem CID | 138973935 |
| Molecular Formula | C22H19FO3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate |
| SMILES | CCc1c(O)c(C(=O)OC)c(-c2ccccc2)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C22H19FO3/c1-3-16-17(14-10-6-4-7-11-14)20(23)18(15-12-8-5-9-13-15)19(21(16)24)22(25)26-2/h4-13,24H,3H2,1-2H3 |
| InChIKey | QLFWJSKXEXCWER-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate?
The IUPAC name of methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate (CID 138973935) is methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate.
What is the SMILES notation for methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate?
The canonical SMILES for methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate is CCc1c(O)c(C(=O)OC)c(-c2ccccc2)c(F)c1-c1ccccc1.
What is the InChIKey of methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate?
The InChIKey is QLFWJSKXEXCWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FO3/c1-3-16-17(14-10-6-4-7-11-14)20(23)18(15-12-8-5-9-13-15)19(21(16)24)22(25)26-2/h4-13,24H,3H2,1-2H3.
What are the key properties of methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate?
methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate has a molecular weight of 350.39 g/mol, XLogP of 5.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethyl-5-fluoro-2-hydroxy-4,6-diphenylbenzoate is sourced from PubChem (CID 138973935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).