About 2-(difluoromethyl)-4,4-difluorobutanamide
2-(difluoromethyl)-4,4-difluorobutanamide (PubChem CID 138973948) has the molecular formula C5H7F4NO
and a molecular weight of 173.11 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,4-difluorobutanamide.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4,4-difluorobutanamide |
| PubChem CID | 138973948 |
| Molecular Formula | C5H7F4NO |
| Molecular Weight | 173.11 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-(difluoromethyl)-4,4-difluorobutanamide |
| SMILES | NC(=O)C(CC(F)F)C(F)F |
| InChI | InChI=1S/C5H7F4NO/c6-3(7)1-2(4(8)9)5(10)11/h2-4H,1H2,(H2,10,11) |
| InChIKey | IUURADPBCVFEBR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.11 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethyl)-4,4-difluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4,4-difluorobutanamide?
The IUPAC name of 2-(difluoromethyl)-4,4-difluorobutanamide (CID 138973948) is 2-(difluoromethyl)-4,4-difluorobutanamide.
What is the SMILES notation for 2-(difluoromethyl)-4,4-difluorobutanamide?
The canonical SMILES for 2-(difluoromethyl)-4,4-difluorobutanamide is NC(=O)C(CC(F)F)C(F)F.
What is the InChIKey of 2-(difluoromethyl)-4,4-difluorobutanamide?
The InChIKey is IUURADPBCVFEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F4NO/c6-3(7)1-2(4(8)9)5(10)11/h2-4H,1H2,(H2,10,11).
What are the key properties of 2-(difluoromethyl)-4,4-difluorobutanamide?
2-(difluoromethyl)-4,4-difluorobutanamide has a molecular weight of 173.11 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4,4-difluorobutanamide is sourced from PubChem (CID 138973948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).