C21H27BFNO2 — CID 138973987
N-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]aniline (PubChem CID 138973987) has the molecular formula C21H27BFNO2 and a molecular weight of 355.26 g/mol. Its IUPAC name is N-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]aniline.
| Compound Name | N-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]aniline |
|---|---|
| PubChem CID | 138973987 |
| Molecular Formula | C21H27BFNO2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]aniline |
| SMILES | CC1(C)OB(c2cc(F)cc(CCCNc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C21H27BFNO2/c1-20(2)21(3,4)26-22(25-20)17-13-16(14-18(23)15-17)9-8-12-24-19-10-6-5-7-11-19/h5-7,10-11,13-15,24H,8-9,12H2,1-4H3 |
| InChIKey | MDIVPMGRKABSNF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|