C11H8OS3 — CID 138974076
5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde (PubChem CID 138974076) has the molecular formula C11H8OS3 and a molecular weight of 252.38 g/mol. Its IUPAC name is 5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde.
| Compound Name | 5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 138974076 |
| Molecular Formula | C11H8OS3 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 5,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
| SMILES | Cc1csc2c1sc1c(C)c(C=O)sc12 |
| InChI | InChI=1S/C11H8OS3/c1-5-4-13-10-8(5)15-9-6(2)7(3-12)14-11(9)10/h3-4H,1-2H3 |
| InChIKey | PJNZZWVYFNPLMI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|