C17H17NO5S — CID 138974107
(3S,3aR,9bS)-7-methoxy-1-methyl-3-phenyl-3a,9b-dihydro-3H-[1,2]benzoxathiino[4,3-c][1,2]oxazole 4,4-dioxide (PubChem CID 138974107) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is (3S,3aR,9bS)-7-methoxy-1-methyl-3-phenyl-3a,9b-dihydro-3H-[1,2]benzoxathiino[4,3-c][1,2]oxazole 4,4-dioxide.
| Compound Name | (3S,3aR,9bS)-7-methoxy-1-methyl-3-phenyl-3a,9b-dihydro-3H-[1,2]benzoxathiino[4,3-c][1,2]oxazole 4,4-dioxide |
|---|---|
| PubChem CID | 138974107 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (3S,3aR,9bS)-7-methoxy-1-methyl-3-phenyl-3a,9b-dihydro-3H-[1,2]benzoxathiino[4,3-c][1,2]oxazole 4,4-dioxide |
| SMILES | COc1ccc2c(c1)OS(=O)(=O)[C@H]1[C@H](c3ccccc3)ON(C)[C@@H]21 |
| InChI | InChI=1S/C17H17NO5S/c1-18-15-13-9-8-12(21-2)10-14(13)23-24(19,20)17(15)16(22-18)11-6-4-3-5-7-11/h3-10,15-17H,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | VGGDLBDACNNBMR-YESZJQIVSA-N |
| XLogP | 2.45 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|