About 3-pyrimidin-5-ylpropyl acetate
3-pyrimidin-5-ylpropyl acetate (PubChem CID 138974434) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-pyrimidin-5-ylpropyl acetate.
Molecular Properties
| Compound Name | 3-pyrimidin-5-ylpropyl acetate |
| PubChem CID | 138974434 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-pyrimidin-5-ylpropyl acetate |
| SMILES | CC(=O)OCCCc1cncnc1 |
| InChI | InChI=1S/C9H12N2O2/c1-8(12)13-4-2-3-9-5-10-7-11-6-9/h5-7H,2-4H2,1H3 |
| InChIKey | ABOZPWUMFOTVLV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrimidin-5-ylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrimidin-5-ylpropyl acetate?
The IUPAC name of 3-pyrimidin-5-ylpropyl acetate (CID 138974434) is 3-pyrimidin-5-ylpropyl acetate.
What is the SMILES notation for 3-pyrimidin-5-ylpropyl acetate?
The canonical SMILES for 3-pyrimidin-5-ylpropyl acetate is CC(=O)OCCCc1cncnc1.
What is the InChIKey of 3-pyrimidin-5-ylpropyl acetate?
The InChIKey is ABOZPWUMFOTVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-8(12)13-4-2-3-9-5-10-7-11-6-9/h5-7H,2-4H2,1H3.
What are the key properties of 3-pyrimidin-5-ylpropyl acetate?
3-pyrimidin-5-ylpropyl acetate has a molecular weight of 180.21 g/mol, XLogP of 0.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrimidin-5-ylpropyl acetate is sourced from PubChem (CID 138974434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).