About 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide
3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide (PubChem CID 138974592) has the molecular formula C11H15F2NO3S
and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide |
| PubChem CID | 138974592 |
| Molecular Formula | C11H15F2NO3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(C(F)(F)CCCCO)c1 |
| InChI | InChI=1S/C11H15F2NO3S/c12-11(13,6-1-2-7-15)9-4-3-5-10(8-9)18(14,16)17/h3-5,8,15H,1-2,6-7H2,(H2,14,16,17) |
| InChIKey | OJPYUKXCCATKLY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide?
The IUPAC name of 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide (CID 138974592) is 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide.
What is the SMILES notation for 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide?
The canonical SMILES for 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide is NS(=O)(=O)c1cccc(C(F)(F)CCCCO)c1.
What is the InChIKey of 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide?
The InChIKey is OJPYUKXCCATKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO3S/c12-11(13,6-1-2-7-15)9-4-3-5-10(8-9)18(14,16)17/h3-5,8,15H,1-2,6-7H2,(H2,14,16,17).
What are the key properties of 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide?
3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide has a molecular weight of 279.31 g/mol, XLogP of 1.59, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoro-5-hydroxypentyl)benzenesulfonamide is sourced from PubChem (CID 138974592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).