About benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate
benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate (PubChem CID 138974854) has the molecular formula C22H33NO2Si
and a molecular weight of 371.60 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate |
| PubChem CID | 138974854 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate |
| SMILES | CC[Si](C#C[C@H]1CCCC[C@H]1NC(=O)OCc1ccccc1)(CC)CC |
| InChI | InChI=1S/C22H33NO2Si/c1-4-26(5-2,6-3)17-16-20-14-10-11-15-21(20)23-22(24)25-18-19-12-8-7-9-13-19/h7-9,12-13,20-21H,4-6,10-11,14-15,18H2,1-3H3,(H,23,24)/t20-,21-/m1/s1 |
| InChIKey | NWPGEWUOQTYIOR-NHCUHLMSSA-N |
| XLogP | 5.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate?
The IUPAC name of benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate (CID 138974854) is benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate.
What is the SMILES notation for benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate?
The canonical SMILES for benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate is CC[Si](C#C[C@H]1CCCC[C@H]1NC(=O)OCc1ccccc1)(CC)CC.
What is the InChIKey of benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate?
The InChIKey is NWPGEWUOQTYIOR-NHCUHLMSSA-N. The full InChI is InChI=1S/C22H33NO2Si/c1-4-26(5-2,6-3)17-16-20-14-10-11-15-21(20)23-22(24)25-18-19-12-8-7-9-13-19/h7-9,12-13,20-21H,4-6,10-11,14-15,18H2,1-3H3,(H,23,24)/t20-,21-/m1/s1.
What are the key properties of benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate?
benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate has a molecular weight of 371.60 g/mol, XLogP of 5.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(1R,2R)-2-(2-triethylsilylethynyl)cyclohexyl]carbamate is sourced from PubChem (CID 138974854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).