About 2-methylpropoxymethanedithioate;tetraethylazanium
2-methylpropoxymethanedithioate;tetraethylazanium (PubChem CID 138975035) has the molecular formula C13H29NOS2
and a molecular weight of 279.51 g/mol. Its IUPAC name is 2-methylpropoxymethanedithioate;tetraethylazanium.
Molecular Properties
| Compound Name | 2-methylpropoxymethanedithioate;tetraethylazanium |
| PubChem CID | 138975035 |
| Molecular Formula | C13H29NOS2 |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-methylpropoxymethanedithioate;tetraethylazanium |
| SMILES | CC(C)COC(=S)[S-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C5H10OS2/c1-5-9(6-2,7-3)8-4;1-4(2)3-6-5(7)8/h5-8H2,1-4H3;4H,3H2,1-2H3,(H,7,8)/q+1;/p-1 |
| InChIKey | PRSKOOVLAUSYKS-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropoxymethanedithioate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropoxymethanedithioate;tetraethylazanium?
The IUPAC name of 2-methylpropoxymethanedithioate;tetraethylazanium (CID 138975035) is 2-methylpropoxymethanedithioate;tetraethylazanium.
What is the SMILES notation for 2-methylpropoxymethanedithioate;tetraethylazanium?
The canonical SMILES for 2-methylpropoxymethanedithioate;tetraethylazanium is CC(C)COC(=S)[S-].CC[N+](CC)(CC)CC.
What is the InChIKey of 2-methylpropoxymethanedithioate;tetraethylazanium?
The InChIKey is PRSKOOVLAUSYKS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C5H10OS2/c1-5-9(6-2,7-3)8-4;1-4(2)3-6-5(7)8/h5-8H2,1-4H3;4H,3H2,1-2H3,(H,7,8)/q+1;/p-1.
What are the key properties of 2-methylpropoxymethanedithioate;tetraethylazanium?
2-methylpropoxymethanedithioate;tetraethylazanium has a molecular weight of 279.51 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropoxymethanedithioate;tetraethylazanium is sourced from PubChem (CID 138975035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).