C23H17Br2N — CID 138975143
3,4-bis(4-bromophenyl)-1,6-dimethylisoquinoline (PubChem CID 138975143) has the molecular formula C23H17Br2N and a molecular weight of 467.20 g/mol. Its IUPAC name is 3,4-bis(4-bromophenyl)-1,6-dimethylisoquinoline.
| Compound Name | 3,4-bis(4-bromophenyl)-1,6-dimethylisoquinoline |
|---|---|
| PubChem CID | 138975143 |
| Molecular Formula | C23H17Br2N |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | 3,4-bis(4-bromophenyl)-1,6-dimethylisoquinoline |
| SMILES | Cc1ccc2c(C)nc(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)c2c1 |
| InChI | InChI=1S/C23H17Br2N/c1-14-3-12-20-15(2)26-23(17-6-10-19(25)11-7-17)22(21(20)13-14)16-4-8-18(24)9-5-16/h3-13H,1-2H3 |
| InChIKey | OJWANMWPRWNZQK-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |