C15H13NO4 — CID 138975224
methyl (1R)-1-[(2R)-5-oxo-2H-furan-2-yl]-1H-isoquinoline-2-carboxylate (PubChem CID 138975224) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is methyl (1R)-1-[(2R)-5-oxo-2H-furan-2-yl]-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl (1R)-1-[(2R)-5-oxo-2H-furan-2-yl]-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138975224 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl (1R)-1-[(2R)-5-oxo-2H-furan-2-yl]-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1C=Cc2ccccc2[C@@H]1[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C15H13NO4/c1-19-15(18)16-9-8-10-4-2-3-5-11(10)14(16)12-6-7-13(17)20-12/h2-9,12,14H,1H3/t12-,14-/m1/s1 |
| InChIKey | WZPBOLJXMDLEGF-TZMCWYRMSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |