About 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide
2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide (PubChem CID 138975393) has the molecular formula C6H9F4NO
and a molecular weight of 187.14 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide |
| PubChem CID | 138975393 |
| Molecular Formula | C6H9F4NO |
| Molecular Weight | 187.14 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide |
| SMILES | CNC(=O)C(CC(F)F)C(F)F |
| InChI | InChI=1S/C6H9F4NO/c1-11-6(12)3(5(9)10)2-4(7)8/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | CKPFCGVPVHJTLY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide?
The IUPAC name of 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide (CID 138975393) is 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide.
What is the SMILES notation for 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide?
The canonical SMILES for 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide is CNC(=O)C(CC(F)F)C(F)F.
What is the InChIKey of 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide?
The InChIKey is CKPFCGVPVHJTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F4NO/c1-11-6(12)3(5(9)10)2-4(7)8/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide?
2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide has a molecular weight of 187.14 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4,4-difluoro-N-methylbutanamide is sourced from PubChem (CID 138975393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).