C34H42O3Si — CID 138975810
(12S,17S)-12-[tert-butyl(diphenyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one (PubChem CID 138975810) has the molecular formula C34H42O3Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (12S,17S)-12-[tert-butyl(diphenyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one.
| Compound Name | (12S,17S)-12-[tert-butyl(diphenyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one |
|---|---|
| PubChem CID | 138975810 |
| Molecular Formula | C34H42O3Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | (12S,17S)-12-[tert-butyl(diphenyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one |
| SMILES | CC[C@H]1C#CC#C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CCCCCCCCC(=O)O1 |
| InChI | InChI=1S/C34H42O3Si/c1-5-29-21-19-20-23-30(22-13-9-7-6-8-10-18-28-33(35)36-29)37-38(34(2,3)4,31-24-14-11-15-25-31)32-26-16-12-17-27-32/h11-17,22,24-27,29-30H,5-10,18,28H2,1-4H3/t29-,30-/m0/s1 |
| InChIKey | RPSSIOATMXURTA-KYJUHHDHSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|