C14H16N6 — CID 138975858
3-[2-(azidomethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole (PubChem CID 138975858) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[2-(azidomethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole.
| Compound Name | 3-[2-(azidomethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole |
|---|---|
| PubChem CID | 138975858 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[2-(azidomethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole |
| SMILES | [N-]=[N+]=NCc1ccccc1-n1nnc2c1CCCCC2 |
| InChI | InChI=1S/C14H16N6/c15-18-16-10-11-6-4-5-8-13(11)20-14-9-3-1-2-7-12(14)17-19-20/h4-6,8H,1-3,7,9-10H2 |
| InChIKey | ZAPYJXWNGSULBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|