About methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate
methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate (PubChem CID 138976280) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate.
Molecular Properties
| Compound Name | methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate |
| PubChem CID | 138976280 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate |
| SMILES | C=C1C[C@H](CO)O[C@H]1CCCC[C@H](C)C(=O)OC |
| InChI | InChI=1S/C14H24O4/c1-10(14(16)17-3)6-4-5-7-13-11(2)8-12(9-15)18-13/h10,12-13,15H,2,4-9H2,1,3H3/t10-,12+,13-/m0/s1 |
| InChIKey | WCPQRQNKFJWGMP-UHTWSYAYSA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate?
The IUPAC name of methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate (CID 138976280) is methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate.
What is the SMILES notation for methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate?
The canonical SMILES for methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate is C=C1C[C@H](CO)O[C@H]1CCCC[C@H](C)C(=O)OC.
What is the InChIKey of methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate?
The InChIKey is WCPQRQNKFJWGMP-UHTWSYAYSA-N. The full InChI is InChI=1S/C14H24O4/c1-10(14(16)17-3)6-4-5-7-13-11(2)8-12(9-15)18-13/h10,12-13,15H,2,4-9H2,1,3H3/t10-,12+,13-/m0/s1.
What are the key properties of methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate?
methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate has a molecular weight of 256.34 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-6-[(2S,5R)-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-methylhexanoate is sourced from PubChem (CID 138976280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).