C12H14F3NO — CID 138976349
5-[(2R,4S)-4-methyloxan-2-yl]-2-(trifluoromethyl)pyridine (PubChem CID 138976349) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-[(2R,4S)-4-methyloxan-2-yl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[(2R,4S)-4-methyloxan-2-yl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 138976349 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 5-[(2R,4S)-4-methyloxan-2-yl]-2-(trifluoromethyl)pyridine |
| SMILES | C[C@H]1CCO[C@@H](c2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C12H14F3NO/c1-8-4-5-17-10(6-8)9-2-3-11(16-7-9)12(13,14)15/h2-3,7-8,10H,4-6H2,1H3/t8-,10+/m0/s1 |
| InChIKey | CEJSKTOKRMOCEZ-WCBMZHEXSA-N |
| XLogP | 3.59 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |