C13H6Cl2FNS — CID 138976396
2,4-dichloro-6-(4-fluorophenyl)sulfanylbenzonitrile (PubChem CID 138976396) has the molecular formula C13H6Cl2FNS and a molecular weight of 298.17 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-fluorophenyl)sulfanylbenzonitrile.
| Compound Name | 2,4-dichloro-6-(4-fluorophenyl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 138976396 |
| Molecular Formula | C13H6Cl2FNS |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 2,4-dichloro-6-(4-fluorophenyl)sulfanylbenzonitrile |
| SMILES | N#Cc1c(Cl)cc(Cl)cc1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C13H6Cl2FNS/c14-8-5-12(15)11(7-17)13(6-8)18-10-3-1-9(16)2-4-10/h1-6H |
| InChIKey | LNHIVUHXSIKXGT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |