About 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine
2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine (PubChem CID 138976500) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine.
Molecular Properties
| Compound Name | 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine |
| PubChem CID | 138976500 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine |
| SMILES | C/C=N/CCN(CC/N=C/C)CC/N=C/C |
| InChI | InChI=1S/C12H24N4/c1-4-13-7-10-16(11-8-14-5-2)12-9-15-6-3/h4-6H,7-12H2,1-3H3/b13-4+,14-5+,15-6+ |
| InChIKey | RDBJPSYTALAZDC-ZTDUMNPQSA-N |
| XLogP | 1.56 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine?
The IUPAC name of 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine (CID 138976500) is 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine.
What is the SMILES notation for 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine?
The canonical SMILES for 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine is C/C=N/CCN(CC/N=C/C)CC/N=C/C.
What is the InChIKey of 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine?
The InChIKey is RDBJPSYTALAZDC-ZTDUMNPQSA-N. The full InChI is InChI=1S/C12H24N4/c1-4-13-7-10-16(11-8-14-5-2)12-9-15-6-3/h4-6H,7-12H2,1-3H3/b13-4+,14-5+,15-6+.
What are the key properties of 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine?
2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine has a molecular weight of 224.35 g/mol, XLogP of 1.56, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylideneamino)-N,N-bis[2-(ethylideneamino)ethyl]ethanamine is sourced from PubChem (CID 138976500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).