C26H36O6SSi — CID 138976508
[(3aR,4S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methanesulfonate (PubChem CID 138976508) has the molecular formula C26H36O6SSi and a molecular weight of 504.72 g/mol. Its IUPAC name is [(3aR,4S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methanesulfonate.
| Compound Name | [(3aR,4S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 138976508 |
| Molecular Formula | C26H36O6SSi |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [(3aR,4S,6S,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H](OS(C)(=O)=O)[C@@H]2O1 |
| InChI | InChI=1S/C26H36O6SSi/c1-25(2,3)34(20-13-9-7-10-14-20,21-15-11-8-12-16-21)29-18-19-17-22(32-33(6,27)28)24-23(19)30-26(4,5)31-24/h7-16,19,22-24H,17-18H2,1-6H3/t19-,22-,23+,24-/m0/s1 |
| InChIKey | GISBOMRPNNLPDI-LSUHJGNXSA-N |
| XLogP | 3.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|