C25H50O5Si2 — CID 138976517
ethyl (E,7S,8R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundec-9-enoate (PubChem CID 138976517) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is ethyl (E,7S,8R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundec-9-enoate.
| Compound Name | ethyl (E,7S,8R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundec-9-enoate |
|---|---|
| PubChem CID | 138976517 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | ethyl (E,7S,8R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundec-9-enoate |
| SMILES | CCOC(=O)CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-12-28-23(27)19-15-13-14-17-21(29-31(8,9)24(2,3)4)22(18-16-20-26)30-32(10,11)25(5,6)7/h16,18,20-22H,12-15,17,19H2,1-11H3/b18-16+/t21-,22+/m0/s1 |
| InChIKey | PGJWMOGLKYBIKA-UJBPIODHSA-N |
| XLogP | 7.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|