C18H13F26N — CID 138976549
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-amine (PubChem CID 138976549) has the molecular formula C18H13F26N and a molecular weight of 737.26 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-amine.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-amine |
|---|---|
| PubChem CID | 138976549 |
| Molecular Formula | C18H13F26N |
| Molecular Weight | 737.26 g/mol |
| Exact Mass | 737.06 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)decan-1-amine |
| SMILES | NCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H13F26N/c19-7(20,9(23,24)11(27,28)13(31,32)15(35,36)17(39,40)41)3-1-6(5-45)2-4-8(21,22)10(25,26)12(29,30)14(33,34)16(37,38)18(42,43)44/h6H,1-5,45H2 |
| InChIKey | HAIZESDUIOOGBE-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.26 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|