C12H12Br2 — CID 138976550
1,5-dibromo-2,4-bis(prop-1-enyl)benzene (PubChem CID 138976550) has the molecular formula C12H12Br2 and a molecular weight of 316.04 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(prop-1-enyl)benzene.
| Compound Name | 1,5-dibromo-2,4-bis(prop-1-enyl)benzene |
|---|---|
| PubChem CID | 138976550 |
| Molecular Formula | C12H12Br2 |
| Molecular Weight | 316.04 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 1,5-dibromo-2,4-bis(prop-1-enyl)benzene |
| SMILES | CC=Cc1cc(C=CC)c(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2/c1-3-5-9-7-10(6-4-2)12(14)8-11(9)13/h3-8H,1-2H3 |
| InChIKey | OPLZEFFOMUAVCT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |