About (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane
(5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane (PubChem CID 138976590) has the molecular formula C17H30BrSn-
and a molecular weight of 433.04 g/mol. Its IUPAC name is (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane.
Molecular Properties
| Compound Name | (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane |
| PubChem CID | 138976590 |
| Molecular Formula | C17H30BrSn- |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc[c-]1Br |
| InChI | InChI=1S/C5H3Br.3C4H9.Sn/c6-5-3-1-2-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;/q-1;;;; |
| InChIKey | RYKQXUYTDRWQHP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane?
The IUPAC name of (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane (CID 138976590) is (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane.
What is the SMILES notation for (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane?
The canonical SMILES for (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane is CCCC[Sn](CCCC)(CCCC)c1ccc[c-]1Br.
What is the InChIKey of (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane?
The InChIKey is RYKQXUYTDRWQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Br.3C4H9.Sn/c6-5-3-1-2-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;/q-1;;;;.
What are the key properties of (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane?
(5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane has a molecular weight of 433.04 g/mol, XLogP of 6.22, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromocyclopenta-1,3-dien-1-yl)-tributylstannane is sourced from PubChem (CID 138976590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).