About chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate
chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate (PubChem CID 138976643) has the molecular formula C12H16ClNO3Zn
and a molecular weight of 323.11 g/mol. Its IUPAC name is chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate.
Molecular Properties
| Compound Name | chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate |
| PubChem CID | 138976643 |
| Molecular Formula | C12H16ClNO3Zn |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1[c-]cccc1OC.Cl[Zn+] |
| InChI | InChI=1S/C12H16NO3.ClH.Zn/c1-4-13(5-2)12(14)16-11-9-7-6-8-10(11)15-3;;/h6-8H,4-5H2,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | UYZOGCIEPHEQGQ-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate?
The IUPAC name of chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate (CID 138976643) is chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate.
What is the SMILES notation for chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate?
The canonical SMILES for chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate is CCN(CC)C(=O)Oc1[c-]cccc1OC.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate?
The InChIKey is UYZOGCIEPHEQGQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16NO3.ClH.Zn/c1-4-13(5-2)12(14)16-11-9-7-6-8-10(11)15-3;;/h6-8H,4-5H2,1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate?
chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate has a molecular weight of 323.11 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);(2-methoxybenzene-6-id-1-yl) N,N-diethylcarbamate is sourced from PubChem (CID 138976643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).