About 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one
7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 138976710) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 138976710 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Cc1c(F)ccc2c1C(=O)NCC2 |
| InChI | InChI=1S/C10H10FNO/c1-6-8(11)3-2-7-4-5-12-10(13)9(6)7/h2-3H,4-5H2,1H3,(H,12,13) |
| InChIKey | XRWDPSYYIUHNCA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one (CID 138976710) is 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one is Cc1c(F)ccc2c1C(=O)NCC2.
What is the InChIKey of 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is XRWDPSYYIUHNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c1-6-8(11)3-2-7-4-5-12-10(13)9(6)7/h2-3H,4-5H2,1H3,(H,12,13).
What are the key properties of 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one?
7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 179.19 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-8-methyl-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 138976710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).