About 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid
4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid (PubChem CID 138976788) has the molecular formula C22H31N3O2
and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid |
| PubChem CID | 138976788 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)C(CCC(=O)O)CCN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C22H31N3O2/c1-22(2,3)18(10-11-21(26)27)12-15-25(16-19-8-4-6-13-23-19)17-20-9-5-7-14-24-20/h4-9,13-14,18H,10-12,15-17H2,1-3H3,(H,26,27) |
| InChIKey | MFAIVKGDRYVEGT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The IUPAC name of 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid (CID 138976788) is 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid.
What is the SMILES notation for 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The canonical SMILES for 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid is CC(C)(C)C(CCC(=O)O)CCN(Cc1ccccn1)Cc1ccccn1.
What is the InChIKey of 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid?
The InChIKey is MFAIVKGDRYVEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O2/c1-22(2,3)18(10-11-21(26)27)12-15-25(16-19-8-4-6-13-23-19)17-20-9-5-7-14-24-20/h4-9,13-14,18H,10-12,15-17H2,1-3H3,(H,26,27).
What are the key properties of 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid?
4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid has a molecular weight of 369.51 g/mol, XLogP of 4.40, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-5,5-dimethylhexanoic acid is sourced from PubChem (CID 138976788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).