C38H55NO6Si — CID 138976943
(4R)-4-benzyl-3-[(2R,3R,4E,6E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6-dimethyl-10-phenylmethoxyundeca-4,6-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 138976943) has the molecular formula C38H55NO6Si and a molecular weight of 649.95 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R,4E,6E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6-dimethyl-10-phenylmethoxyundeca-4,6-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R,4E,6E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6-dimethyl-10-phenylmethoxyundeca-4,6-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138976943 |
| Molecular Formula | C38H55NO6Si |
| Molecular Weight | 649.95 g/mol |
| Exact Mass | 649.38 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R,4E,6E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6-dimethyl-10-phenylmethoxyundeca-4,6-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)/C(C)=C/C(C)=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C38H55NO6Si/c1-10-33(36(41)39-32(26-44-37(39)42)24-30-17-13-11-14-18-30)35(40)28(3)23-27(2)21-22-34(45-46(8,9)38(5,6)7)29(4)43-25-31-19-15-12-16-20-31/h11-21,23,29,32-35,40H,10,22,24-26H2,1-9H3/b27-21+,28-23+/t29-,32+,33+,34-,35-/m0/s1 |
| InChIKey | KBSRPOAKYGAMNT-LXVQCFIRSA-N |
| XLogP | 8.24 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.95 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|