C24H30O11 — CID 138976991
methyl (1R,3S,6Z,9S,11Z,13S)-7-acetyloxy-3-(2-methoxy-2-oxoethyl)-3-methyl-5,15-dioxo-9-prop-1-en-2-yl-4,14,16-trioxabicyclo[11.3.0]hexadeca-6,11-diene-12-carboxylate (PubChem CID 138976991) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is methyl (1R,3S,6Z,9S,11Z,13S)-7-acetyloxy-3-(2-methoxy-2-oxoethyl)-3-methyl-5,15-dioxo-9-prop-1-en-2-yl-4,14,16-trioxabicyclo[11.3.0]hexadeca-6,11-diene-12-carboxylate.
| Compound Name | methyl (1R,3S,6Z,9S,11Z,13S)-7-acetyloxy-3-(2-methoxy-2-oxoethyl)-3-methyl-5,15-dioxo-9-prop-1-en-2-yl-4,14,16-trioxabicyclo[11.3.0]hexadeca-6,11-diene-12-carboxylate |
|---|---|
| PubChem CID | 138976991 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | methyl (1R,3S,6Z,9S,11Z,13S)-7-acetyloxy-3-(2-methoxy-2-oxoethyl)-3-methyl-5,15-dioxo-9-prop-1-en-2-yl-4,14,16-trioxabicyclo[11.3.0]hexadeca-6,11-diene-12-carboxylate |
| SMILES | C=C(C)[C@H]1C/C=C(\C(=O)OC)[C@@H]2OC(=O)O[C@@H]2C[C@@](C)(CC(=O)OC)OC(=O)/C=C(\OC(C)=O)C1 |
| InChI | InChI=1S/C24H30O11/c1-13(2)15-7-8-17(22(28)31-6)21-18(33-23(29)34-21)11-24(4,12-20(27)30-5)35-19(26)10-16(9-15)32-14(3)25/h8,10,15,18,21H,1,7,9,11-12H2,2-6H3/b16-10-,17-8-/t15-,18+,21-,24-/m0/s1 |
| InChIKey | DDOXPVFWHIYTKL-VMOMEBCDSA-N |
| XLogP | 2.68 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|