C27H54OSi2 — CID 138977047
tert-butyl-dimethyl-[(Z,3S)-1-tri(propan-2-yl)silyldodec-4-en-1-yn-3-yl]oxysilane (PubChem CID 138977047) has the molecular formula C27H54OSi2 and a molecular weight of 450.90 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,3S)-1-tri(propan-2-yl)silyldodec-4-en-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,3S)-1-tri(propan-2-yl)silyldodec-4-en-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 138977047 |
| Molecular Formula | C27H54OSi2 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,3S)-1-tri(propan-2-yl)silyldodec-4-en-1-yn-3-yl]oxysilane |
| SMILES | CCCCCCC/C=C\[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54OSi2/c1-13-14-15-16-17-18-19-20-26(28-29(11,12)27(8,9)10)21-22-30(23(2)3,24(4)5)25(6)7/h19-20,23-26H,13-18H2,1-12H3/b20-19-/t26-/m0/s1 |
| InChIKey | NJYBMMIDAWFZOF-SZPGXFBLSA-N |
| XLogP | 9.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|