About CID 138977091
CID 138977091 (PubChem CID 138977091) has the molecular formula C14H26N
and a molecular weight of 208.37 g/mol.
Molecular Properties
| Compound Name | CID 138977091 |
| PubChem CID | 138977091 |
| Molecular Formula | C14H26N |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(C)C2CC[CH]CC2N1 |
| InChI | InChI=1S/C14H26N/c1-13(2)9-10-14(3,4)15-12-8-6-5-7-11(12)13/h6,11-12,15H,5,7-10H2,1-4H3 |
| InChIKey | JNAFEUSSUBCLRF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 138977091 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138977091?
The IUPAC name of CID 138977091 (CID 138977091) is not available.
What is the SMILES notation for CID 138977091?
The canonical SMILES for CID 138977091 is CC1(C)CCC(C)(C)C2CC[CH]CC2N1.
What is the InChIKey of CID 138977091?
The InChIKey is JNAFEUSSUBCLRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N/c1-13(2)9-10-14(3,4)15-12-8-6-5-7-11(12)13/h6,11-12,15H,5,7-10H2,1-4H3.
What are the key properties of CID 138977091?
CID 138977091 has a molecular weight of 208.37 g/mol, XLogP of 3.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138977091 is sourced from PubChem (CID 138977091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).