C28H31IN2O6 — CID 138977124
(4S)-4-benzyl-3-[(2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-[(4-nitrophenyl)methoxy]hepta-2,6-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 138977124) has the molecular formula C28H31IN2O6 and a molecular weight of 618.47 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-[(4-nitrophenyl)methoxy]hepta-2,6-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-[(4-nitrophenyl)methoxy]hepta-2,6-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138977124 |
| Molecular Formula | C28H31IN2O6 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | (4S)-4-benzyl-3-[(2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-[(4-nitrophenyl)methoxy]hepta-2,6-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](/C=C(\C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](OCc1ccc([N+](=O)[O-])cc1)/C(C)=C/I |
| InChI | InChI=1S/C28H31IN2O6/c1-4-23(26(20(3)16-29)36-17-22-10-12-24(13-11-22)31(34)35)14-19(2)27(32)30-25(18-37-28(30)33)15-21-8-6-5-7-9-21/h5-14,16,23,25-26H,4,15,17-18H2,1-3H3/b19-14+,20-16+/t23-,25-,26-/m0/s1 |
| InChIKey | HZMZUVLUBBQXRC-SJCYUJPWSA-N |
| XLogP | 6.38 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|