C21H22N4O4S — CID 138977166
2-(dimethylsulfamoyl)-1-(7-hydroxy-1H-indol-3-yl)-N-methyl-1H-isoquinoline-6-carboxamide (PubChem CID 138977166) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-(dimethylsulfamoyl)-1-(7-hydroxy-1H-indol-3-yl)-N-methyl-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-(dimethylsulfamoyl)-1-(7-hydroxy-1H-indol-3-yl)-N-methyl-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138977166 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-(dimethylsulfamoyl)-1-(7-hydroxy-1H-indol-3-yl)-N-methyl-1H-isoquinoline-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)C=CN(S(=O)(=O)N(C)C)C2c1c[nH]c2c(O)cccc12 |
| InChI | InChI=1S/C21H22N4O4S/c1-22-21(27)14-7-8-15-13(11-14)9-10-25(30(28,29)24(2)3)20(15)17-12-23-19-16(17)5-4-6-18(19)26/h4-12,20,23,26H,1-3H3,(H,22,27) |
| InChIKey | BDCQUHITQORAKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |