C20H41IO2Si2 — CID 138977255
tert-butyl-[(Z,1S,3S)-6-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane (PubChem CID 138977255) has the molecular formula C20H41IO2Si2 and a molecular weight of 496.62 g/mol. Its IUPAC name is tert-butyl-[(Z,1S,3S)-6-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1S,3S)-6-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 138977255 |
| Molecular Formula | C20H41IO2Si2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | tert-butyl-[(Z,1S,3S)-6-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C/C=C\I)O[Si](C)(C)C |
| InChI | InChI=1S/C20H41IO2Si2/c1-12-14-17(23-25(10,11)19(2,3)4)20(5,6)18(15-13-16-21)22-24(7,8)9/h12-14,16-18H,15H2,1-11H3/b14-12+,16-13-/t17-,18-/m0/s1 |
| InChIKey | FELVXFXRAYPXSW-RSWXNGJLSA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|