C27H52O3Si2 — CID 138977362
1-[(1S,2R,5R,6R,7R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9-dimethyl-6-tricyclo[5.3.0.02,5]decanyl]ethanone (PubChem CID 138977362) has the molecular formula C27H52O3Si2 and a molecular weight of 480.88 g/mol. Its IUPAC name is 1-[(1S,2R,5R,6R,7R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9-dimethyl-6-tricyclo[5.3.0.02,5]decanyl]ethanone.
| Compound Name | 1-[(1S,2R,5R,6R,7R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9-dimethyl-6-tricyclo[5.3.0.02,5]decanyl]ethanone |
|---|---|
| PubChem CID | 138977362 |
| Molecular Formula | C27H52O3Si2 |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 1-[(1S,2R,5R,6R,7R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9-dimethyl-6-tricyclo[5.3.0.02,5]decanyl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H]2C[C@](C)(CO[Si](C)(C)C(C)(C)C)C[C@@H]2[C@@]2(C)CC[C@@]12O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O3Si2/c1-19(28)22-20-16-25(8,18-29-31(10,11)23(2,3)4)17-21(20)26(9)14-15-27(22,26)30-32(12,13)24(5,6)7/h20-22H,14-18H2,1-13H3/t20-,21+,22-,25+,26-,27-/m1/s1 |
| InChIKey | HRQMKAGPIIHMTK-HDGFEWIESA-N |
| XLogP | 7.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|