C19H18F2O4 — CID 138977418
ethyl 2-(4-acetyl-2-phenylmethoxyphenyl)-2,2-difluoroacetate (PubChem CID 138977418) has the molecular formula C19H18F2O4 and a molecular weight of 348.35 g/mol. Its IUPAC name is ethyl 2-(4-acetyl-2-phenylmethoxyphenyl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-acetyl-2-phenylmethoxyphenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 138977418 |
| Molecular Formula | C19H18F2O4 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | ethyl 2-(4-acetyl-2-phenylmethoxyphenyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(C(C)=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H18F2O4/c1-3-24-18(23)19(20,21)16-10-9-15(13(2)22)11-17(16)25-12-14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | BAMGPUFRFAHEDM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |