C17H30OSi — CID 138977425
tert-butyl-dimethyl-[(3E,5S,8Z)-undeca-3,8-dien-1-yn-5-yl]oxysilane (PubChem CID 138977425) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E,5S,8Z)-undeca-3,8-dien-1-yn-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3E,5S,8Z)-undeca-3,8-dien-1-yn-5-yl]oxysilane |
|---|---|
| PubChem CID | 138977425 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | tert-butyl-dimethyl-[(3E,5S,8Z)-undeca-3,8-dien-1-yn-5-yl]oxysilane |
| SMILES | C#C/C=C/[C@H](CC/C=C\CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-8-10-12-13-15-16(14-11-9-2)18-19(6,7)17(3,4)5/h2,10-12,14,16H,8,13,15H2,1,3-7H3/b12-10-,14-11+/t16-/m1/s1 |
| InChIKey | NGVYUZNIDQJWFQ-FJIOWZTBSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|