C18H34B2O5 — CID 138977463
(1S,2S,3R)-1-methyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-ol (PubChem CID 138977463) has the molecular formula C18H34B2O5 and a molecular weight of 352.09 g/mol. Its IUPAC name is (1S,2S,3R)-1-methyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-ol.
| Compound Name | (1S,2S,3R)-1-methyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 138977463 |
| Molecular Formula | C18H34B2O5 |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (1S,2S,3R)-1-methyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-ol |
| SMILES | CC1(C)OB([C@@H]2CC[C@](C)(O)[C@H]2B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C18H34B2O5/c1-14(2)15(3,4)23-19(22-14)12-10-11-18(9,21)13(12)20-24-16(5,6)17(7,8)25-20/h12-13,21H,10-11H2,1-9H3/t12-,13+,18+/m1/s1 |
| InChIKey | SNGYUHYUFKFJCD-VBHSOAQHSA-N |
| XLogP | 3.46 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|