C21H22Cl2O8 — CID 138977731
dimethyl (4R)-6,10-dichloro-8-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)-4-ethenylspiro[4.5]deca-6,9-diene-2,2-dicarboxylate (PubChem CID 138977731) has the molecular formula C21H22Cl2O8 and a molecular weight of 473.31 g/mol. Its IUPAC name is dimethyl (4R)-6,10-dichloro-8-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)-4-ethenylspiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
| Compound Name | dimethyl (4R)-6,10-dichloro-8-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)-4-ethenylspiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 138977731 |
| Molecular Formula | C21H22Cl2O8 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | dimethyl (4R)-6,10-dichloro-8-(1,3-dimethoxy-1,3-dioxopropan-2-ylidene)-4-ethenylspiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)CC12C(Cl)=CC(=C(C(=O)OC)C(=O)OC)C=C2Cl |
| InChI | InChI=1S/C21H22Cl2O8/c1-6-12-9-20(18(26)30-4,19(27)31-5)10-21(12)13(22)7-11(8-14(21)23)15(16(24)28-2)17(25)29-3/h6-8,12H,1,9-10H2,2-5H3/t12-/m0/s1 |
| InChIKey | USEJTLNUXXXZSL-LBPRGKRZSA-N |
| XLogP | 2.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|